| Name |
N-({1,1-dioxo-octahydro-1lambda6-thiopyrano[2,3-c]pyrrol-4a-yl}methyl)cyclopropanesulfonamide
|
| Molecular Formula |
C11H20N2O4S2
|
| Molecular Weight |
308.4
|
| Smiles |
O=S1(=O)CCCC2(CNS(=O)(=O)C3CC3)CNCC21
|
O=S1(=O)CCCC2(CNS(=O)(=O)C3CC3)CNCC21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.