| Name |
5-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3,3,3-trifluoropropanamido]cyclohex-3-ene-1-carboxylic acid
|
| Molecular Formula |
C25H23F3N2O5
|
| Molecular Weight |
488.5
|
| Smiles |
O=C(NC(C(=O)NC1C=CCC(C(=O)O)C1)C(F)(F)F)OCC1c2ccccc2-c2ccccc21
|
O=C(NC(C(=O)NC1C=CCC(C(=O)O)C1)C(F)(F)F)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.