| Name |
5-(1-amino-3-methylbutyl)-N,N-bis(2-methylpropyl)-1,2,4-oxadiazol-3-amine
|
| Molecular Formula |
C15H30N4O
|
| Molecular Weight |
282.43
|
| Smiles |
CC(C)CC(N)c1nc(N(CC(C)C)CC(C)C)no1
|
CC(C)CC(N)c1nc(N(CC(C)C)CC(C)C)no1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.