| Name |
rac-(1R,3S,4S,5R,6S)-5,6-dihydroxyspiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-3-sulfonyl chloride
|
| Molecular Formula |
C9H13ClO4S
|
| Molecular Weight |
252.72
|
| Smiles |
O=S(=O)(Cl)C1CC2C(O)C(O)C1C21CC1
|
O=S(=O)(Cl)C1CC2C(O)C(O)C1C21CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.