| Name |
Tert-butyl 3-hydroxy-4-{spiro[3.3]heptan-2-yl}pyrrolidine-1-carboxylate
|
| Molecular Formula |
C16H27NO3
|
| Molecular Weight |
281.39
|
| Smiles |
CC(C)(C)OC(=O)N1CC(O)C(C2CC3(CCC3)C2)C1
|
CC(C)(C)OC(=O)N1CC(O)C(C2CC3(CCC3)C2)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.