| Name |
7-(2,2,2-Trifluoroacetamido)-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid
|
| Molecular Formula |
C11H8F3NO5
|
| Molecular Weight |
291.18
|
| Smiles |
O=C(O)c1cc(NC(=O)C(F)(F)F)cc2c1OCCO2
|
O=C(O)c1cc(NC(=O)C(F)(F)F)cc2c1OCCO2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.