| Name |
6-acetyl-hexahydro-2H-[1,4]dioxino[2,3-c]pyrrole-2-carboxylic acid
|
| Molecular Formula |
C9H13NO5
|
| Molecular Weight |
215.20
|
| Smiles |
CC(=O)N1CC2OCC(C(=O)O)OC2C1
|
CC(=O)N1CC2OCC(C(=O)O)OC2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.