| Name |
C.I. Direct Green 7, disodium salt
|
| Molecular Formula |
C35H23Cl2N7Na2O8S2
|
| Molecular Weight |
850.6
|
| Smiles |
Cc1cc(N=Nc2ccc(-c3ccc(N=Nc4c(S(=O)(=O)[O-])cc5cc(S(=O)(=O)[O-])c(N=Nc6cc(Cl)ccc6Cl)c(N)c5c4O)cc3)cc2)ccc1O.[Na+].[Na+]
|
Cc1cc(N=Nc2ccc(-c3ccc(N=Nc4c(S(=O)(=O)[O-])cc5cc(S(=O)(=O)[O-])c(N=Nc6cc(Cl)ccc6Cl)c(N)c5c4O)cc3)cc2)ccc1O.[Na+].[Na+]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.