| Name |
7-Chloro-4,6-difluoro-2-(propan-2-yl)-[1,3]thiazolo[5,4-c]pyridine
|
| Molecular Formula |
C9H7ClF2N2S
|
| Molecular Weight |
248.68
|
| Smiles |
CC(C)c1nc2c(Cl)c(F)nc(F)c2s1
|
CC(C)c1nc2c(Cl)c(F)nc(F)c2s1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.