| Name |
2-[7-(2,2-Difluoroethyl)-[1,3]dioxolo[4,5-f]benzimidazol-6-yl]ethanamine;dihydrochloride
|
| Molecular Formula |
C12H15Cl2F2N3O2
|
| Molecular Weight |
342.17
|
| Smiles |
Cl.Cl.NCCc1nc2cc3c(cc2n1CC(F)F)OCO3
|
Cl.Cl.NCCc1nc2cc3c(cc2n1CC(F)F)OCO3
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.