| Name |
1,2-Dihydro-3,6-pyridazinedione copper(2+) salt (2:1)
|
| Molecular Formula |
C8H6CuN4O4
|
| Molecular Weight |
285.70
|
| Smiles |
O=c1ccc([O-])n[nH]1.O=c1ccc([O-])n[nH]1.[Cu+2]
|
O=c1ccc([O-])n[nH]1.O=c1ccc([O-])n[nH]1.[Cu+2]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.