| Name |
3-(Aminomethyl)-1,1,1,2,2,4,4,4-octafluorobutane
|
| Molecular Formula |
C5H5F8N
|
| Molecular Weight |
231.09
|
| Smiles |
NCC(C(F)(F)F)C(F)(F)C(F)(F)F
|
NCC(C(F)(F)F)C(F)(F)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.