| Name |
tert-butyl N-({5-fluoroimidazo[1,2-a]pyridin-2-yl}methyl)carbamate
|
| Molecular Formula |
C13H16FN3O2
|
| Molecular Weight |
265.28
|
| Smiles |
CC(C)(C)OC(=O)NCc1cn2c(F)cccc2n1
|
CC(C)(C)OC(=O)NCc1cn2c(F)cccc2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.