| Name |
6-Nitro-1,3-benzothiazol-2-amine;trichlorostibane;hydroxide
|
| Molecular Formula |
C7H6Cl3N3O3SSb-
|
| Molecular Weight |
440.3
|
| Smiles |
Cl[Sb](Cl)Cl.Nc1nc2ccc([N+](=O)[O-])cc2s1.[OH-]
|
Cl[Sb](Cl)Cl.Nc1nc2ccc([N+](=O)[O-])cc2s1.[OH-]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.