| Name |
2H-Pyrrolo[3,4-c]pyridine-2-carboxylic acid, 7-fluorooctahydro-6-oxo-, 1,1-dimethylethyl ester
|
| Molecular Formula |
C12H19FN2O3
|
| Molecular Weight |
258.29
|
| Smiles |
CC(C)(C)OC(=O)N1CC2CNC(=O)C(F)C2C1
|
CC(C)(C)OC(=O)N1CC2CNC(=O)C(F)C2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.