| Name |
11H-Indeno[1,2-c]isoquinoline-5-carboxylic acid, 11-oxo-
|
| Molecular Formula |
C17H9NO3
|
| Molecular Weight |
275.26
|
| Smiles |
O=C(O)c1nc2c(c3ccccc13)C(=O)c1ccccc1-2
|
O=C(O)c1nc2c(c3ccccc13)C(=O)c1ccccc1-2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.