| Name |
(3I(2),5I(2),22E)-Ergosta-6,22-diene-3,5,8-triol
|
| Molecular Formula |
C28H46O3
|
| Molecular Weight |
430.7
|
| Smiles |
CC(C)C(C)C=CC(C)C1CCC2C3(O)C=CC4(O)CC(O)CCC4(C)C3CCC12C
|
CC(C)C(C)C=CC(C)C1CCC2C3(O)C=CC4(O)CC(O)CCC4(C)C3CCC12C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.