| Name |
ethyl 4,7-dichloro-2-oxo-2,3-dihydro-1H-indole-3-carboxylate
|
| Molecular Formula |
C11H9Cl2NO3
|
| Molecular Weight |
274.10
|
| Smiles |
CCOC(=O)C1C(=O)Nc2c(Cl)ccc(Cl)c21
|
CCOC(=O)C1C(=O)Nc2c(Cl)ccc(Cl)c21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.