| Name |
tert-butyl 2-[[7-(8-chloronaphthalen-1-yl)-4-[3-(cyanomethyl)-4-(2-fluoroprop-2-enoyl)piperazin-1-yl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]oxymethyl]pyrrolidine-1-carboxylate
|
| Molecular Formula |
C36H41ClFN7O4
|
| Molecular Weight |
690.2
|
| Smiles |
C=C(F)C(=O)N1CCN(c2nc(OCC3CCCN3C(=O)OC(C)(C)C)nc3c2CCN(c2cccc4cccc(Cl)c24)C3)CC1CC#N
|
C=C(F)C(=O)N1CCN(c2nc(OCC3CCCN3C(=O)OC(C)(C)C)nc3c2CCN(c2cccc4cccc(Cl)c24)C3)CC1CC#N
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.