| Name |
(2R)-5,5-difluoro-2-{[(prop-2-en-1-yloxy)carbonyl]amino}pentanoic acid
|
| Molecular Formula |
C9H13F2NO4
|
| Molecular Weight |
237.20
|
| Smiles |
C=CCOC(=O)NC(CCC(F)F)C(=O)O
|
C=CCOC(=O)NC(CCC(F)F)C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.