| Name |
2-[(3R)-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanamido]-5,5-dimethylhexanoic acid
|
| Molecular Formula |
C27H34N2O5
|
| Molecular Weight |
466.6
|
| Smiles |
CC(CC(=O)NC(CCC(C)(C)C)C(=O)O)NC(=O)OCC1c2ccccc2-c2ccccc21
|
CC(CC(=O)NC(CCC(C)(C)C)C(=O)O)NC(=O)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.