| Name |
(2S)-2-({2-[1-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethyl]-1,3-thiazol-4-yl}formamido)propanoic acid
|
| Molecular Formula |
C24H23N3O5S
|
| Molecular Weight |
465.5
|
| Smiles |
CC(NC(=O)c1csc(C(C)NC(=O)OCC2c3ccccc3-c3ccccc32)n1)C(=O)O
|
CC(NC(=O)c1csc(C(C)NC(=O)OCC2c3ccccc3-c3ccccc32)n1)C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.