| Name |
3-(1-ethyl-1H-1,2,4-triazol-5-yl)-2,2,3-trifluoropropanoic acid
|
| Molecular Formula |
C7H8F3N3O2
|
| Molecular Weight |
223.15
|
| Smiles |
CCn1ncnc1C(F)C(F)(F)C(=O)O
|
CCn1ncnc1C(F)C(F)(F)C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.