| Name |
Carbonic acid, oxydi-2,1-ethanediyl bis[4-[1-(4-hydroxyphenyl)-1-methylethyl]phenyl] ester
|
| Molecular Formula |
C36H38O9
|
| Molecular Weight |
614.7
|
| Smiles |
CC(C)(c1ccc(O)cc1)c1ccc(OC(=O)OCCOCCOC(=O)Oc2ccc(C(C)(C)c3ccc(O)cc3)cc2)cc1
|
CC(C)(c1ccc(O)cc1)c1ccc(OC(=O)OCCOCCOC(=O)Oc2ccc(C(C)(C)c3ccc(O)cc3)cc2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.