| Name |
Methyl 2-(3-hydroxy-5,5-dimethyloxolan-3-yl)-2,3-dimethylbutanoate
|
| Molecular Formula |
C13H24O4
|
| Molecular Weight |
244.33
|
| Smiles |
COC(=O)C(C)(C(C)C)C1(O)COC(C)(C)C1
|
COC(=O)C(C)(C(C)C)C1(O)COC(C)(C)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.