| Name |
6-cyclobutyl-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}piperidine-3-carboxylic acid
|
| Molecular Formula |
C25H27NO4
|
| Molecular Weight |
405.5
|
| Smiles |
O=C(O)C1CCC(C2CCC2)N(C(=O)OCC2c3ccccc3-c3ccccc32)C1
|
O=C(O)C1CCC(C2CCC2)N(C(=O)OCC2c3ccccc3-c3ccccc32)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.