| Name |
2-{[(Benzyloxy)carbonyl]amino}-3-chloro-4,6-dimethoxybenzoic acid
|
| Molecular Formula |
C17H16ClNO6
|
| Molecular Weight |
365.8
|
| Smiles |
COc1cc(OC)c(C(=O)O)c(NC(=O)OCc2ccccc2)c1Cl
|
COc1cc(OC)c(C(=O)O)c(NC(=O)OCc2ccccc2)c1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.