| Name |
2-amino-6,6-dioxo-4H,5H,7H-6lambda6-thieno[2,3-c]thiopyran-3-carboxylic acid
|
| Molecular Formula |
C8H9NO4S2
|
| Molecular Weight |
247.3
|
| Smiles |
Nc1sc2c(c1C(=O)O)CCS(=O)(=O)C2
|
Nc1sc2c(c1C(=O)O)CCS(=O)(=O)C2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.