| Name |
rac-(2R,3R)-4-{[(tert-butoxy)carbonyl]amino}-2,3-dihydroxybutanoic acid
|
| Molecular Formula |
C9H17NO6
|
| Molecular Weight |
235.23
|
| Smiles |
CC(C)(C)OC(=O)NCC(O)C(O)C(=O)O
|
CC(C)(C)OC(=O)NCC(O)C(O)C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.