| Name |
5-[(benzyloxy)carbonyl]-4H,5H,6H,7H,8H-furo[3,2-c]azepine-2-carboxylic acid
|
| Molecular Formula |
C17H17NO5
|
| Molecular Weight |
315.32
|
| Smiles |
O=C(O)c1cc2c(o1)CCCN(C(=O)OCc1ccccc1)C2
|
O=C(O)c1cc2c(o1)CCCN(C(=O)OCc1ccccc1)C2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.