| Name |
1-(2-{[(Benzyloxy)carbonyl]amino}ethyl)-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylic acid
|
| Molecular Formula |
C15H15N3O6
|
| Molecular Weight |
333.30
|
| Smiles |
O=C(NCCn1cc(C(=O)O)c(=O)[nH]c1=O)OCc1ccccc1
|
O=C(NCCn1cc(C(=O)O)c(=O)[nH]c1=O)OCc1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.