| Name |
5-(1-amino-2,2-difluorocyclopropyl)-N,N,4-trimethyl-1,3-thiazol-2-amine
|
| Molecular Formula |
C9H13F2N3S
|
| Molecular Weight |
233.28
|
| Smiles |
Cc1nc(N(C)C)sc1C1(N)CC1(F)F
|
Cc1nc(N(C)C)sc1C1(N)CC1(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.