| Name |
(2,2a(2)a(2),4,4a(2)a(2),6,6a(2)a(2)-Hexamethyl[1,1a(2):3a(2),1a(2)a(2)-terphenyl]-2a(2)-yl)diiodoaluminum
|
| Molecular Formula |
C24H25AlI2
|
| Molecular Weight |
594.2
|
| Smiles |
Cc1cc(C)c(-c2cccc(-c3c(C)cc(C)cc3C)c2[Al](I)I)c(C)c1
|
Cc1cc(C)c(-c2cccc(-c3c(C)cc(C)cc3C)c2[Al](I)I)c(C)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.