| Name |
(3aR,4S,9bS)-5-acetyl-8-methyl-3,3a,4,9b-tetrahydrocyclopenta[c]quinoline-4-carboxylic acid
|
| Molecular Formula |
C16H17NO3
|
| Molecular Weight |
271.31
|
| Smiles |
CC(=O)N1c2ccc(C)cc2C2C=CCC2C1C(=O)O
|
CC(=O)N1c2ccc(C)cc2C2C=CCC2C1C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.