| Name |
6-[1-(aminooxy)ethyl]-2,3-difluoro-N,N-dimethylaniline
|
| Molecular Formula |
C10H14F2N2O
|
| Molecular Weight |
216.23
|
| Smiles |
CC(ON)c1ccc(F)c(F)c1N(C)C
|
CC(ON)c1ccc(F)c(F)c1N(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.