| Name |
(S)-N-((R)-1-(6-(3,3-Dioxido-1,3,4-oxathiazinan-4-yl)pyridin-3-yl)-3-(4-hydroxypiperidin-1-yl)propyl)-7-fluoro-7-isopropyl-5,6,7,8-tetrahydrothiazolo[5,4-b]quinoline-2-carboxamide 2,2,2-trifluoroacetate
|
| Molecular Formula |
C32H40F4N6O7S2
|
| Molecular Weight |
760.8
|
| Smiles |
CC(C)C1(F)CCc2nc3sc(C(=O)NC(CCN4CCC(O)CC4)c4ccc(N5CCOCS5(=O)=O)nc4)nc3cc2C1.O=C(O)C(F)(F)F
|
CC(C)C1(F)CCc2nc3sc(C(=O)NC(CCN4CCC(O)CC4)c4ccc(N5CCOCS5(=O)=O)nc4)nc3cc2C1.O=C(O)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.