| Name |
rac-(3R,4S)-3-acetamido-4-(1H-1,2,3-triazol-1-yl)cyclopentane-1-carboxylic acid
|
| Molecular Formula |
C10H14N4O3
|
| Molecular Weight |
238.24
|
| Smiles |
CC(=O)NC1CC(C(=O)O)CC1n1ccnn1
|
CC(=O)NC1CC(C(=O)O)CC1n1ccnn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.