| Name |
2-{2-methyl-5H,6H,7H-cyclopenta[d]pyrimidine-4-carbonyl}-2,3-dihydro-1H-isoindole
|
| Molecular Formula |
C17H17N3O
|
| Molecular Weight |
279.34
|
| Smiles |
Cc1nc2c(c(C(=O)N3Cc4ccccc4C3)n1)CCC2
|
Cc1nc2c(c(C(=O)N3Cc4ccccc4C3)n1)CCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.