| Name | 4-[3-cyclopropyl-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanoyl]-1,4-oxazepane-6-carboxylic acid | 
                        
                        
                        
                    
                 
                
                
                    
                        
                        
                            | Molecular Formula | C27H30N2O6 | 
                        
                        
                            | Molecular Weight | 478.5 | 
                        
                        
                            | Smiles | O=C(NC(CC1CC1)C(=O)N1CCOCC(C(=O)O)C1)OCC1c2ccccc2-c2ccccc21 | 
                        
                        
                    
                 
                
                
                
                
                
                
                
                    
                        O=C(NC(CC1CC1)C(=O)N1CCOCC(C(=O)O)C1)OCC1c2ccccc2-c2ccccc21
                    
                 
                
                
                The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.