| Name |
(9H-fluoren-9-yl)methyl (2S,4R)-2-[(dimethylamino)methyl]-4-hydroxypyrrolidine-1-carboxylate
|
| Molecular Formula |
C22H26N2O3
|
| Molecular Weight |
366.5
|
| Smiles |
CN(C)CC1CC(O)CN1C(=O)OCC1c2ccccc2-c2ccccc21
|
CN(C)CC1CC(O)CN1C(=O)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.