| Name |
tert-butyl N-{2-amino-2-[3-(1H-1,2,3,4-tetrazol-5-yl)phenyl]ethyl}carbamate
|
| Molecular Formula |
C14H20N6O2
|
| Molecular Weight |
304.35
|
| Smiles |
CC(C)(C)OC(=O)NCC(N)c1cccc(-c2nn[nH]n2)c1
|
CC(C)(C)OC(=O)NCC(N)c1cccc(-c2nn[nH]n2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.