| Name |
1H-Pyrimido[4,5-b][1,4]diazepine-2,4(3H,7H)-dione
|
| Molecular Formula |
C7H6N4O2
|
| Molecular Weight |
178.15
|
| Smiles |
O=c1[nH]c2c(c(=O)[nH]1)N=CCC=N2
|
O=c1[nH]c2c(c(=O)[nH]1)N=CCC=N2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.