| Name |
4-(1,1-Dimethylethyl) 7-[3-carboxy-2-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-4-oxo-4H-pyrido[1,2-a]pyrimidin-7-yl]-4,7-diazaspiro[2.5]octane-4-carboxylate
|
| Molecular Formula |
C28H31N7O5
|
| Molecular Weight |
545.6
|
| Smiles |
Cc1cn2nc(-c3nc4ccc(N5CCN(C(=O)OC(C)(C)C)C6(CC6)C5)cn4c(=O)c3C(=O)O)cc(C)c2n1
|
Cc1cn2nc(-c3nc4ccc(N5CCN(C(=O)OC(C)(C)C)C6(CC6)C5)cn4c(=O)c3C(=O)O)cc(C)c2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.