| Name |
tert-butyl N-(1-oxo-2-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}propan-2-yl)carbamate
|
| Molecular Formula |
C13H17N5O3
|
| Molecular Weight |
291.31
|
| Smiles |
CC(C)(C)OC(=O)NC(C)(C=O)c1cnc2n[nH]nc2c1
|
CC(C)(C)OC(=O)NC(C)(C=O)c1cnc2n[nH]nc2c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.