| Name |
4-Chloro-2-(4-{imidazo[1,2-b]pyridazin-6-yl}-1,4-diazepan-1-yl)-1,3-benzothiazole
|
| Molecular Formula |
C18H17ClN6S
|
| Molecular Weight |
384.9
|
| Smiles |
Clc1cccc2sc(N3CCCN(c4ccc5nccn5n4)CC3)nc12
|
Clc1cccc2sc(N3CCCN(c4ccc5nccn5n4)CC3)nc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.