| Name |
rac-(3R,4S)-4-(2,4-dichlorophenyl)-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}pyrrolidine-3-carboxylic acid
|
| Molecular Formula |
C26H21Cl2NO4
|
| Molecular Weight |
482.4
|
| Smiles |
O=C(O)C1CN(C(=O)OCC2c3ccccc3-c3ccccc32)CC1c1ccc(Cl)cc1Cl
|
O=C(O)C1CN(C(=O)OCC2c3ccccc3-c3ccccc32)CC1c1ccc(Cl)cc1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.