| Name |
2-{1,3-dimethyl-1H-thieno[2,3-c]pyrazol-5-yl}pyridine-3,4-diamine
|
| Molecular Formula |
C12H13N5S
|
| Molecular Weight |
259.33
|
| Smiles |
Cc1nn(C)c2sc(-c3nccc(N)c3N)cc12
|
Cc1nn(C)c2sc(-c3nccc(N)c3N)cc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.