| Name |
3-[3-ethoxy-4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanamido]-4,4-difluorobutanoic acid
|
| Molecular Formula |
C25H28F2N2O6
|
| Molecular Weight |
490.5
|
| Smiles |
CCOC(CNC(=O)OCC1c2ccccc2-c2ccccc21)CC(=O)NC(CC(=O)O)C(F)F
|
CCOC(CNC(=O)OCC1c2ccccc2-c2ccccc21)CC(=O)NC(CC(=O)O)C(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.