| Name |
2-{[3-cyclobutyl-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]methyl}pentanoic acid
|
| Molecular Formula |
C28H34N2O5
|
| Molecular Weight |
478.6
|
| Smiles |
CCCC(CNC(=O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C1CCC1)C(=O)O
|
CCCC(CNC(=O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C1CCC1)C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.