| Name |
3-(2,3-Dichlorophenyl)-2,6-difluoroaniline
|
| Molecular Formula |
C12H7Cl2F2N
|
| Molecular Weight |
274.09
|
| Smiles |
Nc1c(F)ccc(-c2cccc(Cl)c2Cl)c1F
|
Nc1c(F)ccc(-c2cccc(Cl)c2Cl)c1F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.